CAS 19764-32-0 appears in our catalog under these names: N-Acetyl-D-tyrosine, Ac–D–Tyr–OH, Acetyl-D-tyrosine, (R)-2-Acetamido-3-(4-hydroxyphenyl)propanoic acid, 97%, 97%, (R)-2-Acetamido-3-(4-hydroxyphenyl)propanoic acid, 98%. Offered by: Chemat Brand, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: on request, 1g, 5g, 2g, 250mg, 25g.
(2R)-2-acetamido-3-(4-hydroxyphenyl)propanoic acid (CAS 19764-32-0) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: (2R)-2-acetamido-3-(4-hydroxyphenyl)propanoic acid. InChIKey: CAHKINHBCWCHCF-SNVBAGLBSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (2R)-2-acetamido-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | CAHKINHBCWCHCF-SNVBAGLBSA-N |
| SMILES | CC(=O)N[C@H](CC1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)