CAS 19766-55-3 is the registry number for 4'-(Dimethylamino)-p-toluenesulfonanilide. Offered by: TRC. Available pack sizes: 10g.
N-[4-(dimethylamino)phenyl]-4-methylbenzenesulfonamide (CAS 19766-55-3) is a chemical compound with the molecular formula C15H18N2O2S and a molecular weight of 290.4 g/mol. IUPAC name: N-[4-(dimethylamino)phenyl]-4-methylbenzenesulfonamide. InChIKey: ZBAWXYZNUKKOKU-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O2S |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | N-[4-(dimethylamino)phenyl]-4-methylbenzenesulfonamide |
| InChIKey | ZBAWXYZNUKKOKU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)