CAS 197801-88-0 appears in our catalog under these names: SN 003, SN 003, SN003. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, Get quote.
1-(1-methoxybutan-2-yl)-N-(4-methoxy-2-methylphenyl)-6-methyltriazolo[4,5-c]pyridin-4-amine (CAS 197801-88-0) is a chemical compound with the molecular formula C19H25N5O2 and a molecular weight of 355.4 g/mol. IUPAC name: 1-(1-methoxybutan-2-yl)-N-(4-methoxy-2-methylphenyl)-6-methyltriazolo[4,5-c]pyridin-4-amine. InChIKey: FZMBHAQCHCEGNN-UHFFFAOYSA-N.
| Molecular formula | C19H25N5O2 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 1-(1-methoxybutan-2-yl)-N-(4-methoxy-2-methylphenyl)-6-methyltriazolo[4,5-c]pyridin-4-amine |
| InChIKey | FZMBHAQCHCEGNN-UHFFFAOYSA-N |
| SMILES | CCC(COC)N1C2=C(C(=NC(=C2)C)NC3=C(C=C(C=C3)OC)C)N=N1 |
Computed by PubChem (NCBI)