Products 3005273-99-1
CAS 3005273-99-1 is the registry number for E3 Ligase Ligand-linker Conjugate 176. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[1-methyl-6-[[(3R,4R)-3-methylpiperidin-4-yl]amino]indazol-3-yl]piperidine-2,6-dione (CAS 3005273-99-1) is a chemical compound with the molecular formula C19H25N5O2 and a molecular weight of 355.4 g/mol. IUPAC name: 3-[1-methyl-6-[[(3R,4R)-3-methylpiperidin-4-yl]amino]indazol-3-yl]piperidine-2,6-dione. InChIKey: MNPZAPDADSECML-KTZGRWMLSA-N.
| Molecular formula | C19H25N5O2 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | 3-[1-methyl-6-[[(3R,4R)-3-methylpiperidin-4-yl]amino]indazol-3-yl]piperidine-2,6-dione |
| InChIKey | MNPZAPDADSECML-KTZGRWMLSA-N |
| SMILES | C[C@@H]1CNCC[C@H]1NC2=CC3=C(C=C2)C(=NN3C)C4CCC(=O)NC4=O |
Computed by PubChem (NCBI)
Synonyms:
E3 Ligase Ligand-linker Conjugate 176, orb3028712