CAS 1978295-65-6 is the registry number for N'-(6-Bromo-2,3-dihydro-1h-inden-1-ylidene)-4-methylbenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 100g, 25g, 5g, 1g.
N-[(E)-(6-bromo-2,3-dihydroinden-1-ylidene)amino]-4-methylbenzenesulfonamide (CAS 1978295-65-6) is a chemical compound with the molecular formula C16H15BrN2O2S and a molecular weight of 379.3 g/mol. IUPAC name: N-[(E)-(6-bromo-2,3-dihydroinden-1-ylidene)amino]-4-methylbenzenesulfonamide. InChIKey: NTQTUKPIMFZZCU-FBMGVBCBSA-N.
| Molecular formula | C16H15BrN2O2S |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | N-[(E)-(6-bromo-2,3-dihydroinden-1-ylidene)amino]-4-methylbenzenesulfonamide |
| InChIKey | NTQTUKPIMFZZCU-FBMGVBCBSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/2\CCC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)