CAS 849216-79-1 is the registry number for ((4-Bromophenyl)sulfonyl)(2-indol-3-ylethyl)amine. Offered by: Biosynth. Available pack sizes: 10g, 25g.
4-bromo-N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide (CAS 849216-79-1) is a chemical compound with the molecular formula C16H15BrN2O2S and a molecular weight of 379.3 g/mol. IUPAC name: 4-bromo-N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide. InChIKey: WATGZYOGSYUGGN-UHFFFAOYSA-N.
| Molecular formula | C16H15BrN2O2S |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | 4-bromo-N-[2-(1H-indol-3-yl)ethyl]benzenesulfonamide |
| InChIKey | WATGZYOGSYUGGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNS(=O)(=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)