CAS 197854-74-3 is the registry number for 2-Fluoronaphthalene-1,3-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluoronaphthalene-1,3-diol (CAS 197854-74-3) is a chemical compound with the molecular formula C10H7FO2 and a molecular weight of 178.16 g/mol. IUPAC name: 2-fluoronaphthalene-1,3-diol. InChIKey: WLXZAWPLOZHUOB-UHFFFAOYSA-N.
| Molecular formula | C10H7FO2 |
|---|---|
| Molecular weight | 178.16 g/mol |
| IUPAC name | 2-fluoronaphthalene-1,3-diol |
| InChIKey | WLXZAWPLOZHUOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2O)F)O |
Computed by PubChem (NCBI)