CAS 2460027-79-4 appears in our catalog under these names: 7-Fluoronaphthalene-1,3-diol, 98%, 98%, 7-Fluoronaphthalene-1,3-diol, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g.
7-fluoronaphthalene-1,3-diol (CAS 2460027-79-4) is a chemical compound with the molecular formula C10H7FO2 and a molecular weight of 178.16 g/mol. IUPAC name: 7-fluoronaphthalene-1,3-diol. InChIKey: BFVNQJDIGYJIDR-UHFFFAOYSA-N.
| Molecular formula | C10H7FO2 |
|---|---|
| Molecular weight | 178.16 g/mol |
| IUPAC name | 7-fluoronaphthalene-1,3-diol |
| InChIKey | BFVNQJDIGYJIDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C(C=C(C=C21)O)O)F |
Computed by PubChem (NCBI)