CAS 1979-97-1 appears in our catalog under these names: 2-(Methylthio)-5-nitropyrimidine-4,6-diol, 97%, 2-(Methylthio)-5-nitropyrimidine-4,6-diol, 95%, 2–(Methylthio)–5–nitropyrimidine–4,6–diol. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 1g, 250mg.
4-hydroxy-2-methylsulfanyl-5-nitro-1H-pyrimidin-6-one (CAS 1979-97-1) is a chemical compound with the molecular formula C5H5N3O4S and a molecular weight of 203.18 g/mol. IUPAC name: 4-hydroxy-2-methylsulfanyl-5-nitro-1H-pyrimidin-6-one. InChIKey: LMCNSMCHUYZUFF-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O4S |
|---|---|
| Molecular weight | 203.18 g/mol |
| IUPAC name | 4-hydroxy-2-methylsulfanyl-5-nitro-1H-pyrimidin-6-one |
| InChIKey | LMCNSMCHUYZUFF-UHFFFAOYSA-N |
| SMILES | CSC1=NC(=C(C(=O)N1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)