CAS 88891-73-0 is the registry number for 2-((3,5-Dihydroxy-1,2,4-triazin-6-yl)thio)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetic acid (CAS 88891-73-0) is a chemical compound with the molecular formula C5H5N3O4S and a molecular weight of 203.18 g/mol. IUPAC name: 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetic acid. InChIKey: DIALFHUPRSIJKT-UHFFFAOYSA-N.
| Molecular formula | C5H5N3O4S |
|---|---|
| Molecular weight | 203.18 g/mol |
| IUPAC name | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetic acid |
| InChIKey | DIALFHUPRSIJKT-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)SC1=NNC(=O)NC1=O |
Computed by PubChem (NCBI)