Products 88891-73-0

CAS 88891-73-0 is the registry number for 2-((3,5-Dihydroxy-1,2,4-triazin-6-yl)thio)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetic acid (CAS 88891-73-0) is a chemical compound with the molecular formula C5H5N3O4S and a molecular weight of 203.18 g/mol. IUPAC name: 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetic acid. InChIKey: DIALFHUPRSIJKT-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5N3O4S
Molecular weight203.18 g/mol
IUPAC name2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)sulfanyl]acetic acid
InChIKeyDIALFHUPRSIJKT-UHFFFAOYSA-N
SMILESC(C(=O)O)SC1=NNC(=O)NC1=O

Computed by PubChem (NCBI)