Products 1979173-42-6
CAS 1979173-42-6 appears in our catalog under these names: Fmoc-Trp(7-Br)-OH 95%, N-Fmoc-7-bromo-L-tryptophan, ≥98%, ≥98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
(2S)-3-(7-bromo-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1979173-42-6) is a chemical compound with the molecular formula C26H21BrN2O4 and a molecular weight of 505.4 g/mol. IUPAC name: (2S)-3-(7-bromo-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: RCVGIVXSKPLQFK-QHCPKHFHSA-N.
| Molecular formula | C26H21BrN2O4 |
|---|---|
| Molecular weight | 505.4 g/mol |
| IUPAC name | (2S)-3-(7-bromo-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | RCVGIVXSKPLQFK-QHCPKHFHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CNC5=C4C=CC=C5Br)C(=O)O |
Computed by PubChem (NCBI)