Products 2373347-24-9
CAS 2373347-24-9 is the registry number for Fmoc-D-Trp(7-Br)-OH, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2R)-3-(7-bromo-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2373347-24-9) is a chemical compound with the molecular formula C26H21BrN2O4 and a molecular weight of 505.4 g/mol. IUPAC name: (2R)-3-(7-bromo-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: RCVGIVXSKPLQFK-HSZRJFAPSA-N.
| Molecular formula | C26H21BrN2O4 |
|---|---|
| Molecular weight | 505.4 g/mol |
| IUPAC name | (2R)-3-(7-bromo-1H-indol-3-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | RCVGIVXSKPLQFK-HSZRJFAPSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CNC5=C4C=CC=C5Br)C(=O)O |
Computed by PubChem (NCBI)