CAS 19794-10-6 appears in our catalog under these names: N-Boc-L-alanyl-L-alanine methyl ester, 98%, 98%, N-Boc-L-alanyl-L-alanine methyl ester, Methyl (2s)-2-[(2s)-2-{[(tert-butoxy)carbonyl]amino}propanamido]propanoate, 98%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, Get quote.
Methyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoate (CAS 19794-10-6) is a chemical compound with the molecular formula C12H22N2O5 and a molecular weight of 274.31 g/mol. IUPAC name: methyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoate. InChIKey: KRWPOGQDZNCNLK-YUMQZZPRSA-N.
| Molecular formula | C12H22N2O5 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | methyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoate |
| InChIKey | KRWPOGQDZNCNLK-YUMQZZPRSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)