CAS 59602-19-6 is the registry number for (R)-Methyl 2-((R)-2-(tert-butoxycarbonylamino)propanamido)propanoate. Offered by: TRC. Available pack sizes: 10g.
Methyl (2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoate (CAS 59602-19-6) is a chemical compound with the molecular formula C12H22N2O5 and a molecular weight of 274.31 g/mol. IUPAC name: methyl (2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoate. InChIKey: KRWPOGQDZNCNLK-HTQZYQBOSA-N.
| Molecular formula | C12H22N2O5 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | methyl (2R)-2-[[(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]propanoate |
| InChIKey | KRWPOGQDZNCNLK-HTQZYQBOSA-N |
| SMILES | C[C@H](C(=O)N[C@H](C)C(=O)OC)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)