Products 1980053-55-1
CAS 1980053-55-1 is the registry number for tert-Butyl [3-(2-amino-1,3-oxazol-4-yl)bicyclo[1.1.1]pent-1-yl]carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[3-(2-amino-1,3-oxazol-4-yl)-1-bicyclo[1.1.1]pentanyl]carbamate (CAS 1980053-55-1) is a chemical compound with the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. IUPAC name: tert-butyl N-[3-(2-amino-1,3-oxazol-4-yl)-1-bicyclo[1.1.1]pentanyl]carbamate. InChIKey: FABGMPLTLUDZAE-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O3 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | tert-butyl N-[3-(2-amino-1,3-oxazol-4-yl)-1-bicyclo[1.1.1]pentanyl]carbamate |
| InChIKey | FABGMPLTLUDZAE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CC(C1)(C2)C3=COC(=N3)N |
Computed by PubChem (NCBI)