Products 198195-25-4
CAS 198195-25-4 is the registry number for Trans-3-(4-aminophenyl)acrylate ethyl ester. Offered by: Biosynth. Available pack sizes: 10g.
Ethyl (E)-3-(4-aminophenyl)prop-2-enoate (CAS 198195-25-4) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: ethyl (E)-3-(4-aminophenyl)prop-2-enoate. InChIKey: NRPMBSHHBFFYBF-VMPITWQZSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | ethyl (E)-3-(4-aminophenyl)prop-2-enoate |
| InChIKey | NRPMBSHHBFFYBF-VMPITWQZSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC=C(C=C1)N |
Computed by PubChem (NCBI)
Synonyms:
Ethyl 4-aminocinnamate, Ethyl p-aminocinnamate, 4-aminocinnamic acid ethyl ester, (E)-Ethyl 4-aminocinnamate, Ethyl trans-4-aminocinnamate, 2-Propenoic acid, 3-(4-aminophenyl)-, ethyl ester, 2-Propenoic acid, 3-(4-aminophenyl)-, ethyl ester, (2E)-, 2-Propenoic acid, 3-(4-aminophenyl)-, ethyl ester, (E)-, NRPMBSHHBFFYBF-VMPITWQZSA-N, Ethyl 3-(4-aminophenyl)acrylate