Products 19825-63-9
CAS 19825-63-9 is the registry number for Pirnabine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3,6,6,9-tetramethyl-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl) acetate (CAS 19825-63-9) is a chemical compound with the molecular formula C19H24O3 and a molecular weight of 300.4 g/mol. IUPAC name: (3,6,6,9-tetramethyl-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl) acetate. InChIKey: AADNQNOXNWEYHS-UHFFFAOYSA-N.
| Molecular formula | C19H24O3 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | (3,6,6,9-tetramethyl-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl) acetate |
| InChIKey | AADNQNOXNWEYHS-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C(C1)C3=C(C=C(C=C3OC(=O)C)C)OC2(C)C |
Computed by PubChem (NCBI)