Products 19835-38-2
CAS 19835-38-2 appears in our catalog under these names: 1–Adamantaneacetyl Chloride, 1-Adamantylacetyl chloride, 1-Adamantaneacetyl Chloride 95%, 1-Adamantaneacetyl Chloride, 95%, 95%, 1-Adamantylacetyl chloride, min. 95 %, 5 g. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Roth. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 100mg, 250mg.
2-(1-adamantyl)acetyl chloride (CAS 19835-38-2) is a chemical compound with the molecular formula C12H17ClO and a molecular weight of 212.71 g/mol. IUPAC name: 2-(1-adamantyl)acetyl chloride. InChIKey: HLQSEJBREPQBRW-UHFFFAOYSA-N.
| Molecular formula | C12H17ClO |
|---|---|
| Molecular weight | 212.71 g/mol |
| IUPAC name | 2-(1-adamantyl)acetyl chloride |
| InChIKey | HLQSEJBREPQBRW-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)CC(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
1-adamantylacetyl chloride, 2-(1-adamantyl)acetyl chloride, 1-Adamantaneacetylchloride, 2-(adamantan-1-yl)acetyl chloride, Tricyclo[3.3.1.13,7]decane-1-acetyl chloride, 2-(1-Adamantyl)ethanoyl chloride, adamantan-1-yl-acetyl chloride, 1-adamantylacetic acid chloride, (adamantan-1-yl)acetyl chloride, tricyclo[3.3.1.1~3,7~]dec-1-ylacetyl chloride