CAS 91561-75-0 appears in our catalog under these names: 4-Chloro-2,6-diisopropylphenol, 95%, 4-chloro-2,6-diisopropylphenol, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
4-chloro-2,6-di(propan-2-yl)phenol (CAS 91561-75-0) is a chemical compound with the molecular formula C12H17ClO and a molecular weight of 212.71 g/mol. IUPAC name: 4-chloro-2,6-di(propan-2-yl)phenol. InChIKey: ZRTAKZQCHCQFAB-UHFFFAOYSA-N.
| Molecular formula | C12H17ClO |
|---|---|
| Molecular weight | 212.71 g/mol |
| IUPAC name | 4-chloro-2,6-di(propan-2-yl)phenol |
| InChIKey | ZRTAKZQCHCQFAB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1O)C(C)C)Cl |
Computed by PubChem (NCBI)