Products 19835-42-8

CAS 19835-42-8 is the registry number for Adamantylmethamphetamine (hydrochloride), 98.0%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 50 mg, 5 mg, 10 mg.

Structural formula: {0} (CAS {1})

1-(1-adamantyl)-N-methylpropan-2-amine;hydrochloride (CAS 19835-42-8) is a chemical compound with the molecular formula C14H26ClN and a molecular weight of 243.81 g/mol. IUPAC name: 1-(1-adamantyl)-N-methylpropan-2-amine;hydrochloride. InChIKey: RQLUJIORESNTSA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H26ClN
Molecular weight243.81 g/mol
IUPAC name1-(1-adamantyl)-N-methylpropan-2-amine;hydrochloride
InChIKeyRQLUJIORESNTSA-UHFFFAOYSA-N
SMILESCC(CC12CC3CC(C1)CC(C3)C2)NC.Cl

Computed by PubChem (NCBI)