CAS 352444-60-1 is the registry number for 1-(3,5-Dimethyladamantan-1-yl)ethan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3,5-dimethyl-1-adamantyl)ethanamine;hydrochloride (CAS 352444-60-1) is a chemical compound with the molecular formula C14H26ClN and a molecular weight of 243.81 g/mol. IUPAC name: 1-(3,5-dimethyl-1-adamantyl)ethanamine;hydrochloride. InChIKey: QVFNIKYWULXIHA-UHFFFAOYSA-N.
| Molecular formula | C14H26ClN |
|---|---|
| Molecular weight | 243.81 g/mol |
| IUPAC name | 1-(3,5-dimethyl-1-adamantyl)ethanamine;hydrochloride |
| InChIKey | QVFNIKYWULXIHA-UHFFFAOYSA-N |
| SMILES | CC(C12CC3CC(C1)(CC(C3)(C2)C)C)N.Cl |
Computed by PubChem (NCBI)