Products 1983995-54-5
CAS 1983995-54-5 is the registry number for [1,1':3',1''-Terphenyl]-2,2'',5,5',5''-pentacarboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-[3-carboxy-5-(2,5-dicarboxyphenyl)phenyl]terephthalic acid (CAS 1983995-54-5) is a chemical compound with the molecular formula C23H14O10 and a molecular weight of 450.3 g/mol. IUPAC name: 2-[3-carboxy-5-(2,5-dicarboxyphenyl)phenyl]terephthalic acid. InChIKey: RWSISFYNEVCJME-UHFFFAOYSA-N.
| Molecular formula | C23H14O10 |
|---|---|
| Molecular weight | 450.3 g/mol |
| IUPAC name | 2-[3-carboxy-5-(2,5-dicarboxyphenyl)phenyl]terephthalic acid |
| InChIKey | RWSISFYNEVCJME-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C2=CC(=CC(=C2)C(=O)O)C3=C(C=CC(=C3)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)