Products 2095288-22-3
CAS 2095288-22-3 is the registry number for [1,1':3',1''-Terphenyl]-2,2'',4,4'',5'-pentacarboxylic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[3-carboxy-5-(2,4-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid (CAS 2095288-22-3) is a chemical compound with the molecular formula C23H14O10 and a molecular weight of 450.3 g/mol. IUPAC name: 4-[3-carboxy-5-(2,4-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid. InChIKey: ZOWZALHSXAQGES-UHFFFAOYSA-N.
| Molecular formula | C23H14O10 |
|---|---|
| Molecular weight | 450.3 g/mol |
| IUPAC name | 4-[3-carboxy-5-(2,4-dicarboxyphenyl)phenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | ZOWZALHSXAQGES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C(=O)O)C2=CC(=CC(=C2)C(=O)O)C3=C(C=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)