Products 1985192-49-1
CAS 1985192-49-1 is the registry number for 3-Amino-n-cyclopentyl-n,5-dimethylbenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-amino-N-cyclopentyl-N,5-dimethylbenzamide (CAS 1985192-49-1) is a chemical compound with the molecular formula C14H20N2O and a molecular weight of 232.32 g/mol. IUPAC name: 3-amino-N-cyclopentyl-N,5-dimethylbenzamide. InChIKey: IDCSECDRQWVNSY-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | 3-amino-N-cyclopentyl-N,5-dimethylbenzamide |
| InChIKey | IDCSECDRQWVNSY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N)C(=O)N(C)C2CCCC2 |
Computed by PubChem (NCBI)