CAS 198543-08-7 is the registry number for Fmoc–Asparaginol(Trt). Offered by: GLPBio. Available pack sizes: 25g, 5g.
9H-fluoren-9-ylmethyl N-[(2S)-1-hydroxy-4-oxo-4-(tritylamino)butan-2-yl]carbamate (CAS 198543-08-7) is a chemical compound with the molecular formula C38H34N2O4 and a molecular weight of 582.7 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-[(2S)-1-hydroxy-4-oxo-4-(tritylamino)butan-2-yl]carbamate. InChIKey: XCPYFGFABGWFFO-PMERELPUSA-N.
| Molecular formula | C38H34N2O4 |
|---|---|
| Molecular weight | 582.7 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-[(2S)-1-hydroxy-4-oxo-4-(tritylamino)butan-2-yl]carbamate |
| InChIKey | XCPYFGFABGWFFO-PMERELPUSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC(=O)C[C@@H](CO)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)