CAS 654670-89-0 appears in our catalog under these names: Fmoc-dap(mtt)-OH, 95%, Fmoc-Dap(Mtt)-OH, >95% (HPLC), Fmoc–Asn(Trt)–ol, Fmoc-L-Dap(Mtt)-OH, Fmoc-Dap(Mtt)-OH 97%. Offered by: Combi-blocks, TRC, GLPBio, Iris Biotech, Ambeed. Available pack sizes: 5g, 250mg, 1g, 500mg, 100g, 25g, 100mg, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[[(4-methylphenyl)-diphenylmethyl]amino]propanoic acid (CAS 654670-89-0) is a chemical compound with the molecular formula C38H34N2O4 and a molecular weight of 582.7 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[[(4-methylphenyl)-diphenylmethyl]amino]propanoic acid. InChIKey: WDZDBCVDBMWMAM-DHUJRADRSA-N.
| Molecular formula | C38H34N2O4 |
|---|---|
| Molecular weight | 582.7 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[[(4-methylphenyl)-diphenylmethyl]amino]propanoic acid |
| InChIKey | WDZDBCVDBMWMAM-DHUJRADRSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)