CAS 1986846-08-5 is the registry number for 5-Amino-1,3-dimethyl-1,3-dihydro-2H-benzimidazol-2-one dihydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg.
5-amino-1,3-dimethylbenzimidazol-2-one;dihydrochloride (CAS 1986846-08-5) is a chemical compound with the molecular formula C9H13Cl2N3O and a molecular weight of 250.12 g/mol. IUPAC name: 5-amino-1,3-dimethylbenzimidazol-2-one;dihydrochloride. InChIKey: NZRNBTSTFMFSGS-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N3O |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | 5-amino-1,3-dimethylbenzimidazol-2-one;dihydrochloride |
| InChIKey | NZRNBTSTFMFSGS-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)N)N(C1=O)C.Cl.Cl |
Computed by PubChem (NCBI)