CAS 946386-61-4 is the registry number for 1-(4,5-dichloroimidazolyl)-2-(hydroxyimino)-3,3-dimethylbutane. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
N-[1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-ylidene]hydroxylamine (CAS 946386-61-4) is a chemical compound with the molecular formula C9H13Cl2N3O and a molecular weight of 250.12 g/mol. IUPAC name: N-[1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-ylidene]hydroxylamine. InChIKey: GZGPHHGRJAAMLM-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N3O |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | N-[1-(4,5-dichloroimidazol-1-yl)-3,3-dimethylbutan-2-ylidene]hydroxylamine |
| InChIKey | GZGPHHGRJAAMLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=NO)CN1C=NC(=C1Cl)Cl |
Computed by PubChem (NCBI)