CAS 19870-74-7 appears in our catalog under these names: Methyl cedryl ether, 96%, (3R,3AS,6R,7R,8aS)-3-methoxy-3,6,8,8-tetramethyloctahydro-1H-3a,7-methanoazulene, 96%, 96%, Cedrol methyl ether, 98.0%, 1H-3a,7-Methanoazulene, octahydro-6-methoxy-3,6,8,8-tetramethyl-, (3R,3aS,6S,7R,8aS)-, 96%, Methyl cedryl ether 96%. Offered by: Combi-blocks, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100g, 5g, 25g, 1g, 1kg, 5kg, 25 g, 10 g.
(1S,2R,5S,7R,8S)-8-methoxy-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undecane (CAS 19870-74-7) is a chemical compound with the molecular formula C16H28O and a molecular weight of 236.39 g/mol. IUPAC name: (1S,2R,5S,7R,8S)-8-methoxy-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undecane. InChIKey: HRGPYCVTDOECMG-WALBABNVSA-N.
| Molecular formula | C16H28O |
|---|---|
| Molecular weight | 236.39 g/mol |
| IUPAC name | (1S,2R,5S,7R,8S)-8-methoxy-2,6,6,8-tetramethyltricyclo[5.3.1.01,5]undecane |
| InChIKey | HRGPYCVTDOECMG-WALBABNVSA-N |
| SMILES | C[C@@H]1CC[C@@H]2[C@]13CC[C@]([C@H](C3)C2(C)C)(C)OC |
Computed by PubChem (NCBI)