CAS 2229683-14-9 is the registry number for 3,6,7,11-Tetramethyldodeca-2,6,10-trien-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg, 250mg.
(2E,6E)-3,6,7,11-tetramethyldodeca-2,6,10-trien-1-ol (CAS 2229683-14-9) is a chemical compound with the molecular formula C16H28O and a molecular weight of 236.39 g/mol. IUPAC name: (2E,6E)-3,6,7,11-tetramethyldodeca-2,6,10-trien-1-ol. InChIKey: KSCZUNTYFHOHMT-LPVXAABHSA-N.
| Molecular formula | C16H28O |
|---|---|
| Molecular weight | 236.39 g/mol |
| IUPAC name | (2E,6E)-3,6,7,11-tetramethyldodeca-2,6,10-trien-1-ol |
| InChIKey | KSCZUNTYFHOHMT-LPVXAABHSA-N |
| SMILES | CC(=CCC/C(=C(\C)/CC/C(=C/CO)/C)/C)C |
Computed by PubChem (NCBI)