Products 1987123-54-5

CAS 1987123-54-5 is the registry number for Piperidine-1,4-dicarboxylic acid 1-tert-butyl ester 4-(1-chloro-2-methyl-propyl) ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 4-O-(1-chloro-2-methylpropyl) piperidine-1,4-dicarboxylate (CAS 1987123-54-5) is a chemical compound with the molecular formula C15H26ClNO4 and a molecular weight of 319.82 g/mol. IUPAC name: 1-O-tert-butyl 4-O-(1-chloro-2-methylpropyl) piperidine-1,4-dicarboxylate. InChIKey: YDHNVKBBEBVOQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26ClNO4
Molecular weight319.82 g/mol
IUPAC name1-O-tert-butyl 4-O-(1-chloro-2-methylpropyl) piperidine-1,4-dicarboxylate
InChIKeyYDHNVKBBEBVOQJ-UHFFFAOYSA-N
SMILESCC(C)C(OC(=O)C1CCN(CC1)C(=O)OC(C)(C)C)Cl

Computed by PubChem (NCBI)