Products 212782-43-9

CAS 212782-43-9 is the registry number for 1-(tert-Butyl) 4-ethyl 4-(2-chloroethyl)piperidine-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 4-O-ethyl 4-(2-chloroethyl)piperidine-1,4-dicarboxylate (CAS 212782-43-9) is a chemical compound with the molecular formula C15H26ClNO4 and a molecular weight of 319.82 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl 4-(2-chloroethyl)piperidine-1,4-dicarboxylate. InChIKey: KIBNEMIIQVFXBM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26ClNO4
Molecular weight319.82 g/mol
IUPAC name1-O-tert-butyl 4-O-ethyl 4-(2-chloroethyl)piperidine-1,4-dicarboxylate
InChIKeyKIBNEMIIQVFXBM-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCN(CC1)C(=O)OC(C)(C)C)CCCl

Computed by PubChem (NCBI)