Products 1987680-47-6

CAS 1987680-47-6 is the registry number for Methyl 6-aminocyclohex-3-ene-1-carboxylate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 6-aminocyclohex-3-ene-1-carboxylate;hydrochloride (CAS 1987680-47-6) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: methyl 6-aminocyclohex-3-ene-1-carboxylate;hydrochloride. InChIKey: ZGEXEHLFCGUQJM-UHFFFAOYSA-N.

Identity
Molecular formulaC8H14ClNO2
Molecular weight191.65 g/mol
IUPAC namemethyl 6-aminocyclohex-3-ene-1-carboxylate;hydrochloride
InChIKeyZGEXEHLFCGUQJM-UHFFFAOYSA-N
SMILESCOC(=O)C1CC=CCC1N.Cl

Computed by PubChem (NCBI)