CAS 19881-18-6 appears in our catalog under these names: Nimesulide Impurity 7 (Nitroscanate), Cantrodifene, 4-Isothiocyanato-4'-nitrodiphenyl Ether, Nitroscanate, 97.0%, 4-Isothiocyanato-4'-nitrodiphenyl ether, 90%. Offered by: Chemat Brand, TRC, MedChemExpress, Fluorochem. Available pack sizes: on request, 250mg, 25mg, 50mg, 250 mg, 100 mg, 100mg.
1-isothiocyanato-4-(4-nitrophenoxy)benzene (CAS 19881-18-6) is a chemical compound with the molecular formula C13H8N2O3S and a molecular weight of 272.28 g/mol. IUPAC name: 1-isothiocyanato-4-(4-nitrophenoxy)benzene. InChIKey: SVMGVZLUIWGYPH-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O3S |
|---|---|
| Molecular weight | 272.28 g/mol |
| IUPAC name | 1-isothiocyanato-4-(4-nitrophenoxy)benzene |
| InChIKey | SVMGVZLUIWGYPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=C=S)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)