CAS 446829-29-4 is the registry number for 5-Oxo-3-phenyl-5H-(1,3)thiazolo(3,2-a)pyrimidine-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylic acid (CAS 446829-29-4) is a chemical compound with the molecular formula C13H8N2O3S and a molecular weight of 272.28 g/mol. IUPAC name: 5-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylic acid. InChIKey: XVIVXZZHTYSUOX-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O3S |
|---|---|
| Molecular weight | 272.28 g/mol |
| IUPAC name | 5-oxo-3-phenyl-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylic acid |
| InChIKey | XVIVXZZHTYSUOX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC3=NC=C(C(=O)N23)C(=O)O |
Computed by PubChem (NCBI)