CAS 19889-99-7 is the registry number for (1S,3S,5S)-6,6-Dimethyl-2-methylidenebicyclo(3.1.1)heptan-3-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S,3S,5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol (CAS 19889-99-7) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: (1S,3S,5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol. InChIKey: LCYXQUJDODZYIJ-YIZRAAEISA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | (1S,3S,5S)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol |
| InChIKey | LCYXQUJDODZYIJ-YIZRAAEISA-N |
| SMILES | CC1([C@H]2C[C@@H]1C(=C)[C@H](C2)O)C |
Computed by PubChem (NCBI)