CAS 19894-98-5 appears in our catalog under these names: (1R,3S,5R)-6,6-dimethyl-2-methylidenebicyclo(3.1.1)heptan-3-ol, 98%, (1R,3S,5R)-6,6-Dimethyl-2-methylidenebicyclo(3.1.1)heptan-3-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg, 0,5g.
(1R,3S,5R)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol (CAS 19894-98-5) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: (1R,3S,5R)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol. InChIKey: LCYXQUJDODZYIJ-VGMNWLOBSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | (1R,3S,5R)-6,6-dimethyl-2-methylidenebicyclo[3.1.1]heptan-3-ol |
| InChIKey | LCYXQUJDODZYIJ-VGMNWLOBSA-N |
| SMILES | CC1([C@@H]2C[C@H]1C(=C)[C@H](C2)O)C |
Computed by PubChem (NCBI)