Products 198895-53-3

CAS 198895-53-3 is the registry number for rac-tert-Butyl N-{((1R,4R)-4-(bromomethyl)cyclohexyl)methyl}carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[[4-(bromomethyl)cyclohexyl]methyl]carbamate (CAS 198895-53-3) is a chemical compound with the molecular formula C13H24BrNO2 and a molecular weight of 306.24 g/mol. IUPAC name: tert-butyl N-[[4-(bromomethyl)cyclohexyl]methyl]carbamate. InChIKey: AJOZRYSXFRMCKE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24BrNO2
Molecular weight306.24 g/mol
IUPAC nametert-butyl N-[[4-(bromomethyl)cyclohexyl]methyl]carbamate
InChIKeyAJOZRYSXFRMCKE-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCC1CCC(CC1)CBr

Computed by PubChem (NCBI)