CAS 2243508-24-7 is the registry number for rel-tert-Butyl (((1R,3S)-3-(bromomethyl)cyclohexyl)methyl)carbamate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-[[(1R,3S)-3-(bromomethyl)cyclohexyl]methyl]carbamate (CAS 2243508-24-7) is a chemical compound with the molecular formula C13H24BrNO2 and a molecular weight of 306.24 g/mol. IUPAC name: tert-butyl N-[[(1R,3S)-3-(bromomethyl)cyclohexyl]methyl]carbamate. InChIKey: RDXOGYMWINSTMZ-WDEREUQCSA-N.
| Molecular formula | C13H24BrNO2 |
|---|---|
| Molecular weight | 306.24 g/mol |
| IUPAC name | tert-butyl N-[[(1R,3S)-3-(bromomethyl)cyclohexyl]methyl]carbamate |
| InChIKey | RDXOGYMWINSTMZ-WDEREUQCSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CCC[C@@H](C1)CBr |
Computed by PubChem (NCBI)