CAS 198953-53-6 appears in our catalog under these names: 5-Methyl-2-trifluoromethyl-4h-[1,2,4]triazolo[1,5-a]pyrimidin-7-one, 95%, 5-Methyl-2-(trifluoromethyl)-(1,2,4)triazolo(1,5-a)pyrimidin-7(4H)-one, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5-methyl-2-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 198953-53-6) is a chemical compound with the molecular formula C7H5F3N4O and a molecular weight of 218.14 g/mol. IUPAC name: 5-methyl-2-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: RCFXSBDEUTWHMQ-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N4O |
|---|---|
| Molecular weight | 218.14 g/mol |
| IUPAC name | 5-methyl-2-(trifluoromethyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | RCFXSBDEUTWHMQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=N1)N=C(N2)C(F)(F)F |
Computed by PubChem (NCBI)