CAS 951005-70-2 is the registry number for 1-Methyl-6-(trifluoromethyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-methyl-6-(trifluoromethyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 951005-70-2) is a chemical compound with the molecular formula C7H5F3N4O and a molecular weight of 218.14 g/mol. IUPAC name: 1-methyl-6-(trifluoromethyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: YVVKFTRAXUMBHU-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N4O |
|---|---|
| Molecular weight | 218.14 g/mol |
| IUPAC name | 1-methyl-6-(trifluoromethyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | YVVKFTRAXUMBHU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=O)NC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)