CAS 1989671-34-2 appears in our catalog under these names: 4-Bromo-2-(4-methylphenoxy)aniline hydrochloride, 4-Bromo-2-(4-methylphenoxy)aniline hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
4-bromo-2-(4-methylphenoxy)aniline;hydrochloride (CAS 1989671-34-2) is a chemical compound with the molecular formula C13H13BrClNO and a molecular weight of 314.60 g/mol. IUPAC name: 4-bromo-2-(4-methylphenoxy)aniline;hydrochloride. InChIKey: KIXQUSKQQVGDES-UHFFFAOYSA-N.
| Molecular formula | C13H13BrClNO |
|---|---|
| Molecular weight | 314.60 g/mol |
| IUPAC name | 4-bromo-2-(4-methylphenoxy)aniline;hydrochloride |
| InChIKey | KIXQUSKQQVGDES-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=C(C=CC(=C2)Br)N.Cl |
Computed by PubChem (NCBI)