CAS 215113-01-2 appears in our catalog under these names: 4-(Benzyloxy)-3-bromoaniline hydrochloride, 95%, 4-(Benzyloxy)-3-bromoaniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-bromo-4-phenylmethoxyaniline;hydrochloride (CAS 215113-01-2) is a chemical compound with the molecular formula C13H13BrClNO and a molecular weight of 314.60 g/mol. IUPAC name: 3-bromo-4-phenylmethoxyaniline;hydrochloride. InChIKey: UZLUVEXKEONRQI-UHFFFAOYSA-N.
| Molecular formula | C13H13BrClNO |
|---|---|
| Molecular weight | 314.60 g/mol |
| IUPAC name | 3-bromo-4-phenylmethoxyaniline;hydrochloride |
| InChIKey | UZLUVEXKEONRQI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)N)Br.Cl |
Computed by PubChem (NCBI)