CAS 1989671-37-5 is the registry number for 1-Methanesulfonyl-3-methylazetidin-3-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-methyl-1-methylsulfonylazetidin-3-amine;hydrochloride (CAS 1989671-37-5) is a chemical compound with the molecular formula C5H13ClN2O2S and a molecular weight of 200.69 g/mol. IUPAC name: 3-methyl-1-methylsulfonylazetidin-3-amine;hydrochloride. InChIKey: MGUSZENKHSVBJM-UHFFFAOYSA-N.
| Molecular formula | C5H13ClN2O2S |
|---|---|
| Molecular weight | 200.69 g/mol |
| IUPAC name | 3-methyl-1-methylsulfonylazetidin-3-amine;hydrochloride |
| InChIKey | MGUSZENKHSVBJM-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)S(=O)(=O)C)N.Cl |
Computed by PubChem (NCBI)