Products 1989671-53-5
CAS 1989671-53-5 is the registry number for 1-((tert-Butoxy)carbonyl)-2,2-dimethylcyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,2-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropane-1-carboxylic acid (CAS 1989671-53-5) is a chemical compound with the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. IUPAC name: 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropane-1-carboxylic acid. InChIKey: SBBWYOZYXPWSHZ-UHFFFAOYSA-N.
| Molecular formula | C11H18O4 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | 2,2-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]cyclopropane-1-carboxylic acid |
| InChIKey | SBBWYOZYXPWSHZ-UHFFFAOYSA-N |
| SMILES | CC1(CC1(C(=O)O)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)