CAS 1989671-57-9 appears in our catalog under these names: N1,N1-Dimethylspiro(3.3)heptane-1,3-diamine dihydrochloride, 95%, N1,N1-Dimethylspiro(3.3)heptane-1,3-diamine dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-N,3-N-dimethylspiro[3.3]heptane-1,3-diamine;dihydrochloride (CAS 1989671-57-9) is a chemical compound with the molecular formula C9H20Cl2N2 and a molecular weight of 227.17 g/mol. IUPAC name: 3-N,3-N-dimethylspiro[3.3]heptane-1,3-diamine;dihydrochloride. InChIKey: DNZXOHZMIMSVND-UHFFFAOYSA-N.
| Molecular formula | C9H20Cl2N2 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | 3-N,3-N-dimethylspiro[3.3]heptane-1,3-diamine;dihydrochloride |
| InChIKey | DNZXOHZMIMSVND-UHFFFAOYSA-N |
| SMILES | CN(C)C1CC(C12CCC2)N.Cl.Cl |
Computed by PubChem (NCBI)