CAS 1989824-37-4 is the registry number for (1,3-Benzodioxol-5-ylmethyl)(2-nitrobenzyl)amine hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(1,3-benzodioxol-5-yl)-N-[(2-nitrophenyl)methyl]methanamine;hydrobromide (CAS 1989824-37-4) is a chemical compound with the molecular formula C15H15BrN2O4 and a molecular weight of 367.19 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-N-[(2-nitrophenyl)methyl]methanamine;hydrobromide. InChIKey: UUVRQACWSLJLCW-UHFFFAOYSA-N.
| Molecular formula | C15H15BrN2O4 |
|---|---|
| Molecular weight | 367.19 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-N-[(2-nitrophenyl)methyl]methanamine;hydrobromide |
| InChIKey | UUVRQACWSLJLCW-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CNCC3=CC=CC=C3[N+](=O)[O-].Br |
Computed by PubChem (NCBI)