CAS 2883559-55-3 is the registry number for 3-[5-(2-bromoethoxy)-1-oxo-isoindolin-2-yl]piperidine-2,6-dione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[6-(2-bromoethoxy)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2883559-55-3) is a chemical compound with the molecular formula C15H15BrN2O4 and a molecular weight of 367.19 g/mol. IUPAC name: 3-[6-(2-bromoethoxy)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: WDUHBCCFLBZLLP-UHFFFAOYSA-N.
| Molecular formula | C15H15BrN2O4 |
|---|---|
| Molecular weight | 367.19 g/mol |
| IUPAC name | 3-[6-(2-bromoethoxy)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | WDUHBCCFLBZLLP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)OCCBr |
Computed by PubChem (NCBI)