CAS 199119-46-5 appears in our catalog under these names: H-D-His(Trt)-OH, 98%, Nim-Trityl-D-histidine, (R)-2-Amino-3-(1-trityl-1H-imidazol-4-yl)propanoic acid, 98%, 98%, D-Histidine, 1-(triphenylmethyl)-, 98%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 100g, 5g, 2g, 500mg, 100mg, 250mg.
(2R)-2-amino-3-(1-tritylimidazol-4-yl)propanoic acid (CAS 199119-46-5) is a chemical compound with the molecular formula C25H23N3O2 and a molecular weight of 397.5 g/mol. IUPAC name: (2R)-2-amino-3-(1-tritylimidazol-4-yl)propanoic acid. InChIKey: BSZQZNOAYQCQFZ-HSZRJFAPSA-N.
| Molecular formula | C25H23N3O2 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | (2R)-2-amino-3-(1-tritylimidazol-4-yl)propanoic acid |
| InChIKey | BSZQZNOAYQCQFZ-HSZRJFAPSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)