Products 2413110-72-0
CAS 2413110-72-0 is the registry number for Mtt-Imidazol-OH. Offered by: Iris Biotech. Available pack sizes: 250mg, 500mg, 1g, 5g, 25g.
1-methyl-4-[[(4-methylphenyl)-diphenylmethyl]amino]imidazole-2-carboxylic acid (CAS 2413110-72-0) is a chemical compound with the molecular formula C25H23N3O2 and a molecular weight of 397.5 g/mol. IUPAC name: 1-methyl-4-[[(4-methylphenyl)-diphenylmethyl]amino]imidazole-2-carboxylic acid. InChIKey: NXOJWLMFGTVZSQ-UHFFFAOYSA-N.
| Molecular formula | C25H23N3O2 |
|---|---|
| Molecular weight | 397.5 g/mol |
| IUPAC name | 1-methyl-4-[[(4-methylphenyl)-diphenylmethyl]amino]imidazole-2-carboxylic acid |
| InChIKey | NXOJWLMFGTVZSQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)NC4=CN(C(=N4)C(=O)O)C |
Computed by PubChem (NCBI)